C26H35N3O4 — CID 58815700
2-methoxyethyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate (PubChem CID 58815700) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 2-methoxyethyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate.
| Compound Name | 2-methoxyethyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate |
|---|---|
| PubChem CID | 58815700 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 2-methoxyethyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate |
| SMILES | COCCOC(=O)N1C2CCC3CC(N4CCC5(CC4)CN(C(C)=O)c4ccccc45)CC321 |
| InChI | InChI=1S/C26H35N3O4/c1-18(30)28-17-25(21-5-3-4-6-22(21)28)9-11-27(12-10-25)20-15-19-7-8-23-26(19,16-20)29(23)24(31)33-14-13-32-2/h3-6,19-20,23H,7-17H2,1-2H3 |
| InChIKey | WINNFDPJEHCFLK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|