About 1,3-ditert-butyl-3a,7a-dihydroindole
1,3-ditert-butyl-3a,7a-dihydroindole (PubChem CID 58816510) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 1,3-ditert-butyl-3a,7a-dihydroindole.
Molecular Properties
| Compound Name | 1,3-ditert-butyl-3a,7a-dihydroindole |
| PubChem CID | 58816510 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1,3-ditert-butyl-3a,7a-dihydroindole |
| SMILES | CC(C)(C)C1=CN(C(C)(C)C)C2C=CC=CC12 |
| InChI | InChI=1S/C16H25N/c1-15(2,3)13-11-17(16(4,5)6)14-10-8-7-9-12(13)14/h7-12,14H,1-6H3 |
| InChIKey | UMYFVOGAFXABCH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-ditert-butyl-3a,7a-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-ditert-butyl-3a,7a-dihydroindole?
The IUPAC name of 1,3-ditert-butyl-3a,7a-dihydroindole (CID 58816510) is 1,3-ditert-butyl-3a,7a-dihydroindole.
What is the SMILES notation for 1,3-ditert-butyl-3a,7a-dihydroindole?
The canonical SMILES for 1,3-ditert-butyl-3a,7a-dihydroindole is CC(C)(C)C1=CN(C(C)(C)C)C2C=CC=CC12.
What is the InChIKey of 1,3-ditert-butyl-3a,7a-dihydroindole?
The InChIKey is UMYFVOGAFXABCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-15(2,3)13-11-17(16(4,5)6)14-10-8-7-9-12(13)14/h7-12,14H,1-6H3.
What are the key properties of 1,3-ditert-butyl-3a,7a-dihydroindole?
1,3-ditert-butyl-3a,7a-dihydroindole has a molecular weight of 231.38 g/mol, XLogP of 4.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-ditert-butyl-3a,7a-dihydroindole is sourced from PubChem (CID 58816510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).