About 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine
2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine (PubChem CID 58816776) has the molecular formula C40H28S2
and a molecular weight of 572.80 g/mol. Its IUPAC name is 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine.
Molecular Properties
| Compound Name | 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine |
| PubChem CID | 58816776 |
| Molecular Formula | C40H28S2 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine |
| SMILES | C1=C(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)SC(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)=CS1 |
| InChI | InChI=1S/C40H28S2/c1-3-7-29(8-4-1)31-11-15-33(16-12-31)35-19-23-37(24-20-35)39-27-41-28-40(42-39)38-25-21-36(22-26-38)34-17-13-32(14-18-34)30-9-5-2-6-10-30/h1-28H |
| InChIKey | LURSHSOIIOLIJR-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine?
The IUPAC name of 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine (CID 58816776) is 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine.
What is the SMILES notation for 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine?
The canonical SMILES for 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine is C1=C(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)SC(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)=CS1.
What is the InChIKey of 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine?
The InChIKey is LURSHSOIIOLIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H28S2/c1-3-7-29(8-4-1)31-11-15-33(16-12-31)35-19-23-37(24-20-35)39-27-41-28-40(42-39)38-25-21-36(22-26-38)34-17-13-32(14-18-34)30-9-5-2-6-10-30/h1-28H.
What are the key properties of 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine?
2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine has a molecular weight of 572.80 g/mol, XLogP of 12.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[4-(4-phenylphenyl)phenyl]-1,4-dithiine is sourced from PubChem (CID 58816776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).