C14H13N3O2 — CID 588168
12-methyl-10,12,14-triazatetracyclo[7.5.2.02,7.010,14]hexadeca-2,4,6,15-tetraene-11,13-dione (PubChem CID 588168) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 12-methyl-10,12,14-triazatetracyclo[7.5.2.02,7.010,14]hexadeca-2,4,6,15-tetraene-11,13-dione.
| Compound Name | 12-methyl-10,12,14-triazatetracyclo[7.5.2.02,7.010,14]hexadeca-2,4,6,15-tetraene-11,13-dione |
|---|---|
| PubChem CID | 588168 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 12-methyl-10,12,14-triazatetracyclo[7.5.2.02,7.010,14]hexadeca-2,4,6,15-tetraene-11,13-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1C=CC2Cc2ccccc21 |
| InChI | InChI=1S/C14H13N3O2/c1-15-13(18)16-10-6-7-12(17(16)14(15)19)11-5-3-2-4-9(11)8-10/h2-7,10,12H,8H2,1H3 |
| InChIKey | IVRQUNDOJHVELD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|