C25H8O4 — CID 58816898
9-[3-(8-carboxyocta-1,3,5,7-tetraynyl)-5-methylphenyl]nona-2,4,6,8-tetraynoic acid (PubChem CID 58816898) has the molecular formula C25H8O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is 9-[3-(8-carboxyocta-1,3,5,7-tetraynyl)-5-methylphenyl]nona-2,4,6,8-tetraynoic acid.
| Compound Name | 9-[3-(8-carboxyocta-1,3,5,7-tetraynyl)-5-methylphenyl]nona-2,4,6,8-tetraynoic acid |
|---|---|
| PubChem CID | 58816898 |
| Molecular Formula | C25H8O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 9-[3-(8-carboxyocta-1,3,5,7-tetraynyl)-5-methylphenyl]nona-2,4,6,8-tetraynoic acid |
| SMILES | Cc1cc(C#CC#CC#CC#CC(=O)O)cc(C#CC#CC#CC#CC(=O)O)c1 |
| InChI | InChI=1S/C25H8O4/c1-21-18-22(14-10-6-2-4-8-12-16-24(26)27)20-23(19-21)15-11-7-3-5-9-13-17-25(28)29/h18-20H,1H3,(H,26,27)(H,28,29) |
| InChIKey | FTXPZUNMDYITEC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|