C20H44N4 — CID 58816940
1,2,3,4,5,6,7,8,9,10,11,12-dodecamethyl-1,4,7,10-tetrazacyclododecane (PubChem CID 58816940) has the molecular formula C20H44N4 and a molecular weight of 340.60 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11,12-dodecamethyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecamethyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 58816940 |
| Molecular Formula | C20H44N4 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.36 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecamethyl-1,4,7,10-tetrazacyclododecane |
| SMILES | CC1C(C)N(C)C(C)C(C)N(C)C(C)C(C)N(C)C(C)C(C)N1C |
| InChI | InChI=1S/C20H44N4/c1-13-14(2)22(10)17(5)18(6)24(12)20(8)19(7)23(11)16(4)15(3)21(13)9/h13-20H,1-12H3 |
| InChIKey | FSXCBLDLTXEJHF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |