C17H35N3O2 — CID 58816967
2-tert-butyl-5-(hydrazinecarbonyl)-4,4,7,7-tetramethyloctanamide (PubChem CID 58816967) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 2-tert-butyl-5-(hydrazinecarbonyl)-4,4,7,7-tetramethyloctanamide.
| Compound Name | 2-tert-butyl-5-(hydrazinecarbonyl)-4,4,7,7-tetramethyloctanamide |
|---|---|
| PubChem CID | 58816967 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | 2-tert-butyl-5-(hydrazinecarbonyl)-4,4,7,7-tetramethyloctanamide |
| SMILES | CC(C)(C)CC(C(=O)NN)C(C)(C)CC(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C17H35N3O2/c1-15(2,3)9-12(14(22)20-19)17(7,8)10-11(13(18)21)16(4,5)6/h11-12H,9-10,19H2,1-8H3,(H2,18,21)(H,20,22) |
| InChIKey | WVDBCKQBRZPYAI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|