C16H30O2 — CID 58816996
4,4-bis(methoxymethyl)-1,2,3,3,6,6-hexamethylcyclohexene (PubChem CID 58816996) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 4,4-bis(methoxymethyl)-1,2,3,3,6,6-hexamethylcyclohexene.
| Compound Name | 4,4-bis(methoxymethyl)-1,2,3,3,6,6-hexamethylcyclohexene |
|---|---|
| PubChem CID | 58816996 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 4,4-bis(methoxymethyl)-1,2,3,3,6,6-hexamethylcyclohexene |
| SMILES | COCC1(COC)CC(C)(C)C(C)=C(C)C1(C)C |
| InChI | InChI=1S/C16H30O2/c1-12-13(2)15(5,6)16(10-17-7,11-18-8)9-14(12,3)4/h9-11H2,1-8H3 |
| InChIKey | OEJMOTMSQJBPLF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|