C30H31NO5 — CID 58817277
(2R,4S)-2-ethoxy-4-(9H-fluoren-2-yl)-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 58817277) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is (2R,4S)-2-ethoxy-4-(9H-fluoren-2-yl)-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4S)-2-ethoxy-4-(9H-fluoren-2-yl)-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 58817277 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (2R,4S)-2-ethoxy-4-(9H-fluoren-2-yl)-N-(2-hydroxyphenyl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)Nc2ccccc2O)=C[C@H](c2ccc3c(c2)Cc2ccccc2-3)C1CCCO |
| InChI | InChI=1S/C30H31NO5/c1-2-35-30-24(10-7-15-32)25(18-28(36-30)29(34)31-26-11-5-6-12-27(26)33)20-13-14-23-21(17-20)16-19-8-3-4-9-22(19)23/h3-6,8-9,11-14,17-18,24-25,30,32-33H,2,7,10,15-16H2,1H3,(H,31,34)/t24?,25-,30-/m1/s1 |
| InChIKey | DTCBOJCCJUSNLH-BSPUMGQNSA-N |
| XLogP | 5.35 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|