About 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole
5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole (PubChem CID 58817498) has the molecular formula C14H11F2NS
and a molecular weight of 263.31 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 58817498 |
| Molecular Formula | C14H11F2NS |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1cccc(F)c1C1=NC(c2cccs2)CC1 |
| InChI | InChI=1S/C14H11F2NS/c15-9-3-1-4-10(16)14(9)12-7-6-11(17-12)13-5-2-8-18-13/h1-5,8,11H,6-7H2 |
| InChIKey | WOMRZJKVUFPFNU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole (CID 58817498) is 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole is Fc1cccc(F)c1C1=NC(c2cccs2)CC1.
What is the InChIKey of 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole?
The InChIKey is WOMRZJKVUFPFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NS/c15-9-3-1-4-10(16)14(9)12-7-6-11(17-12)13-5-2-8-18-13/h1-5,8,11H,6-7H2.
What are the key properties of 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole?
5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole has a molecular weight of 263.31 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-difluorophenyl)-2-thiophen-2-yl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 58817498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).