C37H37N3O4 — CID 58818079
(1R)-N,N-bis(1,3-benzodioxol-5-ylmethyl)-1-(3-butyl-2,5-diphenylimidazol-4-yl)ethanamine (PubChem CID 58818079) has the molecular formula C37H37N3O4 and a molecular weight of 587.72 g/mol. Its IUPAC name is (1R)-N,N-bis(1,3-benzodioxol-5-ylmethyl)-1-(3-butyl-2,5-diphenylimidazol-4-yl)ethanamine.
| Compound Name | (1R)-N,N-bis(1,3-benzodioxol-5-ylmethyl)-1-(3-butyl-2,5-diphenylimidazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 58818079 |
| Molecular Formula | C37H37N3O4 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | (1R)-N,N-bis(1,3-benzodioxol-5-ylmethyl)-1-(3-butyl-2,5-diphenylimidazol-4-yl)ethanamine |
| SMILES | CCCCn1c(-c2ccccc2)nc(-c2ccccc2)c1[C@@H](C)N(Cc1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C37H37N3O4/c1-3-4-19-40-36(35(29-11-7-5-8-12-29)38-37(40)30-13-9-6-10-14-30)26(2)39(22-27-15-17-31-33(20-27)43-24-41-31)23-28-16-18-32-34(21-28)44-25-42-32/h5-18,20-21,26H,3-4,19,22-25H2,1-2H3/t26-/m1/s1 |
| InChIKey | CJAQREINIOBJTC-AREMUKBSSA-N |
| XLogP | 8.24 |
| TPSA | 57.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |