About 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine
4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine (PubChem CID 58818490) has the molecular formula C12H23F2N
and a molecular weight of 219.32 g/mol. Its IUPAC name is 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine |
| PubChem CID | 58818490 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine |
| SMILES | CC(C)NC1(C(C)C)CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H23F2N/c1-9(2)11(15-10(3)4)5-7-12(13,14)8-6-11/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | MAQOAAWONBWBJO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine?
The IUPAC name of 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine (CID 58818490) is 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine.
What is the SMILES notation for 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine?
The canonical SMILES for 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine is CC(C)NC1(C(C)C)CCC(F)(F)CC1.
What is the InChIKey of 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine?
The InChIKey is MAQOAAWONBWBJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2N/c1-9(2)11(15-10(3)4)5-7-12(13,14)8-6-11/h9-10,15H,5-8H2,1-4H3.
What are the key properties of 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine?
4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine has a molecular weight of 219.32 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-N,1-di(propan-2-yl)cyclohexan-1-amine is sourced from PubChem (CID 58818490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).