C12H14F8O8S2-2 — CID 58819265
1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)methyl]cyclohexyl]methoxy]ethanesulfonate (PubChem CID 58819265) has the molecular formula C12H14F8O8S2-2 and a molecular weight of 502.35 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)methyl]cyclohexyl]methoxy]ethanesulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)methyl]cyclohexyl]methoxy]ethanesulfonate |
|---|---|
| PubChem CID | 58819265 |
| Molecular Formula | C12H14F8O8S2-2 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.00 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[[4-[(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)methyl]cyclohexyl]methoxy]ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OCC1CCC(COC(F)(F)C(F)(F)SOO[O-])CC1 |
| InChI | InChI=1S/C12H16F8O8S2/c13-9(14,11(17,18)29-28-27-21)25-5-7-1-3-8(4-2-7)6-26-10(15,16)12(19,20)30(22,23)24/h7-8,21H,1-6H2,(H,22,23,24)/p-2 |
| InChIKey | KFAYUFZMRSAXCO-UHFFFAOYSA-L |
| XLogP | 2.61 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|