C26H39ClN6O — CID 58819411
1-[5-(6-tert-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)-2-methylphenyl]-3-decylurea (PubChem CID 58819411) has the molecular formula C26H39ClN6O and a molecular weight of 487.09 g/mol. Its IUPAC name is 1-[5-(6-tert-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)-2-methylphenyl]-3-decylurea.
| Compound Name | 1-[5-(6-tert-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)-2-methylphenyl]-3-decylurea |
|---|---|
| PubChem CID | 58819411 |
| Molecular Formula | C26H39ClN6O |
| Molecular Weight | 487.09 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 1-[5-(6-tert-butyl-7-chloro-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)-2-methylphenyl]-3-decylurea |
| SMILES | CCCCCCCCCCNC(=O)Nc1cc(-c2nc3c(Cl)c(C(C)(C)C)[nH]n3n2)ccc1C |
| InChI | InChI=1S/C26H39ClN6O/c1-6-7-8-9-10-11-12-13-16-28-25(34)29-20-17-19(15-14-18(20)2)23-30-24-21(27)22(26(3,4)5)31-33(24)32-23/h14-15,17,31H,6-13,16H2,1-5H3,(H2,28,29,34) |
| InChIKey | DLFSOBLJRHGEAY-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.09 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|