C23H43Cl2NSiZr — CID 58819839
[2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl(dimethyl)silyl]-(1-methylcyclohexyl)azanide;carbanide;dichlorozirconium(2+) (PubChem CID 58819839) has the molecular formula C23H43Cl2NSiZr and a molecular weight of 523.82 g/mol. Its IUPAC name is [2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl(dimethyl)silyl]-(1-methylcyclohexyl)azanide;carbanide;dichlorozirconium(2+).
| Compound Name | [2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl(dimethyl)silyl]-(1-methylcyclohexyl)azanide;carbanide;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 58819839 |
| Molecular Formula | C23H43Cl2NSiZr |
| Molecular Weight | 523.82 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | [2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluoren-9-yl(dimethyl)silyl]-(1-methylcyclohexyl)azanide;carbanide;dichlorozirconium(2+) |
| SMILES | CC1([N-][Si](C)(C)C2C3CCCCC3C3CCCCC32)CCCCC1.Cl[Zr+2]Cl.[CH3-] |
| InChI | InChI=1S/C22H40NSi.CH3.2ClH.Zr/c1-22(15-9-4-10-16-22)23-24(2,3)21-19-13-7-5-11-17(19)18-12-6-8-14-20(18)21;;;;/h17-21H,4-16H2,1-3H3;1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | WWZHXQXHZXACMG-UHFFFAOYSA-L |
| XLogP | 9.11 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.82 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|