C16H11ClN6O5 — CID 58819947
[(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3,5-dioxopiperazine-1-carboxylate (PubChem CID 58819947) has the molecular formula C16H11ClN6O5 and a molecular weight of 402.75 g/mol. Its IUPAC name is [(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3,5-dioxopiperazine-1-carboxylate.
| Compound Name | [(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3,5-dioxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58819947 |
| Molecular Formula | C16H11ClN6O5 |
| Molecular Weight | 402.75 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [(7R)-6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3,5-dioxopiperazine-1-carboxylate |
| SMILES | O=C1CN(C(=O)O[C@@H]2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC(=O)N1 |
| InChI | InChI=1S/C16H11ClN6O5/c17-8-1-2-9(20-5-8)23-14(26)12-13(19-4-3-18-12)15(23)28-16(27)22-6-10(24)21-11(25)7-22/h1-5,15H,6-7H2,(H,21,24,25)/t15-/m1/s1 |
| InChIKey | YBEPABOKTHWPCO-OAHLLOKOSA-N |
| XLogP | 0.28 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.75 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|