About [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate
[6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate (PubChem CID 58819954) has the molecular formula C16H13ClN6O4
and a molecular weight of 388.77 g/mol. Its IUPAC name is [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate.
Molecular Properties
| Compound Name | [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate |
| PubChem CID | 58819954 |
| Molecular Formula | C16H13ClN6O4 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate |
| SMILES | O=C1CN(C(=O)OC2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CCN1 |
| InChI | InChI=1S/C16H13ClN6O4/c17-9-1-2-10(21-7-9)23-14(25)12-13(20-4-3-19-12)15(23)27-16(26)22-6-5-18-11(24)8-22/h1-4,7,15H,5-6,8H2,(H,18,24) |
| InChIKey | MFANEWZHPSWPNE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate?
The IUPAC name of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate (CID 58819954) is [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate.
What is the SMILES notation for [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate?
The canonical SMILES for [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate is O=C1CN(C(=O)OC2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CCN1.
What is the InChIKey of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate?
The InChIKey is MFANEWZHPSWPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN6O4/c17-9-1-2-10(21-7-9)23-14(25)12-13(20-4-3-19-12)15(23)27-16(26)22-6-5-18-11(24)8-22/h1-4,7,15H,5-6,8H2,(H,18,24).
What are the key properties of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate?
[6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate has a molecular weight of 388.77 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-oxopiperazine-1-carboxylate is sourced from PubChem (CID 58819954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).