C22H21NO6 — CID 58820296
[(2R,3R,4S)-4-benzamido-4-ethyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate (PubChem CID 58820296) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is [(2R,3R,4S)-4-benzamido-4-ethyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S)-4-benzamido-4-ethyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 58820296 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [(2R,3R,4S)-4-benzamido-4-ethyl-5-oxo-2-(2-oxoethyl)oxolan-3-yl] benzoate |
| SMILES | CC[C@@]1(NC(=O)c2ccccc2)C(=O)O[C@H](CC=O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21NO6/c1-2-22(23-19(25)15-9-5-3-6-10-15)18(17(13-14-24)28-21(22)27)29-20(26)16-11-7-4-8-12-16/h3-12,14,17-18H,2,13H2,1H3,(H,23,25)/t17-,18+,22+/m1/s1 |
| InChIKey | CRZANTSIPOSYKY-FGSXEWAUSA-N |
| XLogP | 2.31 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|