About 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol
2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol (PubChem CID 58820336) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol |
| PubChem CID | 58820336 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1nc(C)c(CCO)s1 |
| InChI | InChI=1S/C7H11NOS/c1-5-7(3-4-9)10-6(2)8-5/h9H,3-4H2,1-2H3 |
| InChIKey | BQQBMZMSRDSGKP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol?
The IUPAC name of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol (CID 58820336) is 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol.
What is the SMILES notation for 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol?
The canonical SMILES for 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol is Cc1nc(C)c(CCO)s1.
What is the InChIKey of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol?
The InChIKey is BQQBMZMSRDSGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NOS/c1-5-7(3-4-9)10-6(2)8-5/h9H,3-4H2,1-2H3.
What are the key properties of 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol?
2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol has a molecular weight of 157.24 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanol is sourced from PubChem (CID 58820336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).