C26H31N3O — CID 58820516
1-benzyl-8-[(1S,2S)-2-phenylcyclohexyl]-1,3,8-triazaspiro[4.5]dec-2-en-4-one (PubChem CID 58820516) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-benzyl-8-[(1S,2S)-2-phenylcyclohexyl]-1,3,8-triazaspiro[4.5]dec-2-en-4-one.
| Compound Name | 1-benzyl-8-[(1S,2S)-2-phenylcyclohexyl]-1,3,8-triazaspiro[4.5]dec-2-en-4-one |
|---|---|
| PubChem CID | 58820516 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 1-benzyl-8-[(1S,2S)-2-phenylcyclohexyl]-1,3,8-triazaspiro[4.5]dec-2-en-4-one |
| SMILES | O=C1N=CN(Cc2ccccc2)C12CCN([C@H]1CCCC[C@H]1c1ccccc1)CC2 |
| InChI | InChI=1S/C26H31N3O/c30-25-26(29(20-27-25)19-21-9-3-1-4-10-21)15-17-28(18-16-26)24-14-8-7-13-23(24)22-11-5-2-6-12-22/h1-6,9-12,20,23-24H,7-8,13-19H2/t23-,24-/m0/s1 |
| InChIKey | RJOHOHGTEHXUDM-ZEQRLZLVSA-N |
| XLogP | 4.62 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |