C22H30F3N3O — CID 58820524
8-[(1S,2S)-2-phenylcyclohexyl]-1-(3,3,3-trifluoropropyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 58820524) has the molecular formula C22H30F3N3O and a molecular weight of 409.50 g/mol. Its IUPAC name is 8-[(1S,2S)-2-phenylcyclohexyl]-1-(3,3,3-trifluoropropyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(1S,2S)-2-phenylcyclohexyl]-1-(3,3,3-trifluoropropyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 58820524 |
| Molecular Formula | C22H30F3N3O |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 8-[(1S,2S)-2-phenylcyclohexyl]-1-(3,3,3-trifluoropropyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCN(CCC(F)(F)F)C12CCN([C@H]1CCCC[C@H]1c1ccccc1)CC2 |
| InChI | InChI=1S/C22H30F3N3O/c23-22(24,25)12-15-28-16-26-20(29)21(28)10-13-27(14-11-21)19-9-5-4-8-18(19)17-6-2-1-3-7-17/h1-3,6-7,18-19H,4-5,8-16H2,(H,26,29)/t18-,19-/m0/s1 |
| InChIKey | GKDBNHMAUAQLAV-OALUTQOASA-N |
| XLogP | 3.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |