C52F36N2 — CID 58820640
2,3,5,6-tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazine (PubChem CID 58820640) has the molecular formula C52F36N2 and a molecular weight of 1336.51 g/mol. Its IUPAC name is 2,3,5,6-tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazine.
| Compound Name | 2,3,5,6-tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 58820640 |
| Molecular Formula | C52F36N2 |
| Molecular Weight | 1336.51 g/mol |
| Exact Mass | 1335.95 |
| IUPAC Name | 2,3,5,6-tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazine |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(-c3nc(-c4c(F)c(F)c(-c5c(F)c(F)c(F)c(F)c5F)c(F)c4F)c(-c4c(F)c(F)c(-c5c(F)c(F)c(F)c(F)c5F)c(F)c4F)nc3-c3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C52F36N2/c53-13-1(5-21(61)37(77)45(85)38(78)22(5)62)14(54)30(70)9(29(13)69)49-50(10-31(71)15(55)2(16(56)32(10)72)6-23(63)39(79)46(86)40(80)24(6)64)90-52(12-35(75)19(59)4(20(60)36(12)76)8-27(67)43(83)48(88)44(84)28(8)68)51(89-49)11-33(73)17(57)3(18(58)34(11)74)7-25(65)41(81)47(87)42(82)26(7)66 |
| InChIKey | IINZXKRYNKEFQS-UHFFFAOYSA-N |
| XLogP | 18.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1336.51 |
| LogP ≤ 5 | 18.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|