About 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate
3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 58820688) has the molecular formula C15H25FN2O3
and a molecular weight of 300.37 g/mol. Its IUPAC name is 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate.
Molecular Properties
| Compound Name | 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
| PubChem CID | 58820688 |
| Molecular Formula | C15H25FN2O3 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCCCF)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C15H25FN2O3/c1-14(2)7-12(18-13(20)21-6-4-5-16)8-15(3,9-14)10-17-11-19/h12H,4-10H2,1-3H3,(H,18,20) |
| InChIKey | YMSBLPOXDIRQIL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
The IUPAC name of 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate (CID 58820688) is 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate.
What is the SMILES notation for 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
The canonical SMILES for 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate is CC1(C)CC(NC(=O)OCCCF)CC(C)(CN=C=O)C1.
What is the InChIKey of 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
The InChIKey is YMSBLPOXDIRQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25FN2O3/c1-14(2)7-12(18-13(20)21-6-4-5-16)8-15(3,9-14)10-17-11-19/h12H,4-10H2,1-3H3,(H,18,20).
What are the key properties of 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate?
3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate has a molecular weight of 300.37 g/mol, XLogP of 2.99, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropropyl N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]carbamate is sourced from PubChem (CID 58820688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).