C17H20F12O2 — CID 58820902
2-[6-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58820902) has the molecular formula C17H20F12O2 and a molecular weight of 484.32 g/mol. Its IUPAC name is 2-[6-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[6-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58820902 |
| Molecular Formula | C17H20F12O2 |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-[6-(2-butan-2-yloxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)OC(C1CC2CC1C(C(O)(C(F)(F)F)C(F)(F)F)C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H20F12O2/c1-3-7(2)31-13(16(24,25)26,17(27,28)29)11-6-8-4-9(11)10(5-8)12(30,14(18,19)20)15(21,22)23/h7-11,30H,3-6H2,1-2H3 |
| InChIKey | NVEFLLVXILTQJE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |