C11H15F9O3 — CID 58820906
2-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-2,3,3-trifluorobutane (PubChem CID 58820906) has the molecular formula C11H15F9O3 and a molecular weight of 366.22 g/mol. Its IUPAC name is 2-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-2,3,3-trifluorobutane.
| Compound Name | 2-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-2,3,3-trifluorobutane |
|---|---|
| PubChem CID | 58820906 |
| Molecular Formula | C11H15F9O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]oxy-2,3,3-trifluorobutane |
| SMILES | CCOC(C)OC(OC(C)(F)C(C)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F9O3/c1-5-21-6(2)22-9(10(15,16)17,11(18,19)20)23-8(4,14)7(3,12)13/h6H,5H2,1-4H3 |
| InChIKey | XORYXLIXIUJYAM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|