C26H41F3O2 — CID 58820941
decyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 58820941) has the molecular formula C26H41F3O2 and a molecular weight of 442.61 g/mol. Its IUPAC name is decyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | decyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 58820941 |
| Molecular Formula | C26H41F3O2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | decyl 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1(C(F)(F)F)CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C26H41F3O2/c1-4-5-6-7-8-9-10-11-12-31-24(30)25(26(27,28)29)15-18-13-21(25)23-20-14-19(22(18)23)16(2)17(20)3/h16-23H,4-15H2,1-3H3 |
| InChIKey | JSPSTLHXOVDPDG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|