About N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide
N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide (PubChem CID 58820990) has the molecular formula C21H38N4O4S
and a molecular weight of 442.63 g/mol. Its IUPAC name is N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide |
| PubChem CID | 58820990 |
| Molecular Formula | C21H38N4O4S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide |
| SMILES | CC(=O)NS(=O)(=O)CCCCOc1c(CN(C)C)cc(CN(C)C)cc1CN(C)C |
| InChI | InChI=1S/C21H38N4O4S/c1-17(26)22-30(27,28)11-9-8-10-29-21-19(15-24(4)5)12-18(14-23(2)3)13-20(21)16-25(6)7/h12-13H,8-11,14-16H2,1-7H3,(H,22,26) |
| InChIKey | YMWKDMHIJQKMEJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide?
The IUPAC name of N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide (CID 58820990) is N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide.
What is the SMILES notation for N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide?
The canonical SMILES for N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide is CC(=O)NS(=O)(=O)CCCCOc1c(CN(C)C)cc(CN(C)C)cc1CN(C)C.
What is the InChIKey of N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide?
The InChIKey is YMWKDMHIJQKMEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N4O4S/c1-17(26)22-30(27,28)11-9-8-10-29-21-19(15-24(4)5)12-18(14-23(2)3)13-20(21)16-25(6)7/h12-13H,8-11,14-16H2,1-7H3,(H,22,26).
What are the key properties of N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide?
N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide has a molecular weight of 442.63 g/mol, XLogP of 1.50, 13 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2,4,6-tris[(dimethylamino)methyl]phenoxy]butylsulfonyl]acetamide is sourced from PubChem (CID 58820990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).