C31H35BrN2O8S — CID 58821161
2-[[2-[(7-bromo-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-(2,3-dihydroxyphenyl)acetic acid (PubChem CID 58821161) has the molecular formula C31H35BrN2O8S and a molecular weight of 675.60 g/mol. Its IUPAC name is 2-[[2-[(7-bromo-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-(2,3-dihydroxyphenyl)acetic acid.
| Compound Name | 2-[[2-[(7-bromo-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-(2,3-dihydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 58821161 |
| Molecular Formula | C31H35BrN2O8S |
| Molecular Weight | 675.60 g/mol |
| Exact Mass | 674.13 |
| IUPAC Name | 2-[[2-[(7-bromo-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]acetyl]amino]-2-(2,3-dihydroxyphenyl)acetic acid |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(Br)c(OCC(=O)NC(C(=O)O)c3cccc(O)c3O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C31H35BrN2O8S/c1-3-5-14-31(4-2)18-34(20-10-7-6-8-11-20)23-15-22(32)25(16-26(23)43(40,41)19-31)42-17-27(36)33-28(30(38)39)21-12-9-13-24(35)29(21)37/h6-13,15-16,28,35,37H,3-5,14,17-19H2,1-2H3,(H,33,36)(H,38,39) |
| InChIKey | OZWWMNQGDMTAGS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|