About N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide
N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide (PubChem CID 58821461) has the molecular formula C13H28N2O2S
and a molecular weight of 276.45 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide |
| PubChem CID | 58821461 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide |
| SMILES | CC(C)N[C@H](CN(C)S(=O)(=O)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O2S/c1-10(2)14-12(13(3,4)5)9-15(6)18(16,17)11-7-8-11/h10-12,14H,7-9H2,1-6H3/t12-/m1/s1 |
| InChIKey | LHTJPICNGZZINZ-GFCCVEGCSA-N |
| XLogP | 1.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide?
The IUPAC name of N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide (CID 58821461) is N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide.
What is the SMILES notation for N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide?
The canonical SMILES for N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide is CC(C)N[C@H](CN(C)S(=O)(=O)C1CC1)C(C)(C)C.
What is the InChIKey of N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide?
The InChIKey is LHTJPICNGZZINZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H28N2O2S/c1-10(2)14-12(13(3,4)5)9-15(6)18(16,17)11-7-8-11/h10-12,14H,7-9H2,1-6H3/t12-/m1/s1.
What are the key properties of N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide?
N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide has a molecular weight of 276.45 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-dimethyl-2-(propan-2-ylamino)butyl]-N-methylcyclopropanesulfonamide is sourced from PubChem (CID 58821461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).