About N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide
N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide (PubChem CID 58821706) has the molecular formula C11H25N3O2S
and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide |
| PubChem CID | 58821706 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide |
| SMILES | CC(C)(C)[C@H](N)CNS(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H25N3O2S/c1-11(2,3)10(12)9-13-17(15,16)14-7-5-4-6-8-14/h10,13H,4-9,12H2,1-3H3/t10-/m1/s1 |
| InChIKey | DTQAOIMOKSPVKQ-SNVBAGLBSA-N |
| XLogP | 0.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide?
The IUPAC name of N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide (CID 58821706) is N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide.
What is the SMILES notation for N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide?
The canonical SMILES for N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide is CC(C)(C)[C@H](N)CNS(=O)(=O)N1CCCCC1.
What is the InChIKey of N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide?
The InChIKey is DTQAOIMOKSPVKQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H25N3O2S/c1-11(2,3)10(12)9-13-17(15,16)14-7-5-4-6-8-14/h10,13H,4-9,12H2,1-3H3/t10-/m1/s1.
What are the key properties of N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide?
N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide has a molecular weight of 263.41 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-amino-3,3-dimethylbutyl]piperidine-1-sulfonamide is sourced from PubChem (CID 58821706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).