C22H26N2O5 — CID 58822147
benzyl N-[(1S,2R)-4-hydroxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamate (PubChem CID 58822147) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is benzyl N-[(1S,2R)-4-hydroxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2R)-4-hydroxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58822147 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | benzyl N-[(1S,2R)-4-hydroxy-2-(phenylmethoxycarbonylamino)cyclohexyl]carbamate |
| SMILES | O=C(N[C@H]1CCC(O)C[C@H]1NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O5/c25-18-11-12-19(23-21(26)28-14-16-7-3-1-4-8-16)20(13-18)24-22(27)29-15-17-9-5-2-6-10-17/h1-10,18-20,25H,11-15H2,(H,23,26)(H,24,27)/t18?,19-,20+/m0/s1 |
| InChIKey | OOJGPUKRLSGFFZ-NRRUETGQSA-N |
| XLogP | 3.12 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |