C18H23BN2O4 — CID 58822322
CID 58822322 (PubChem CID 58822322) has the molecular formula C18H23BN2O4 and a molecular weight of 342.20 g/mol.
| Compound Name | CID 58822322 |
|---|---|
| PubChem CID | 58822322 |
| Molecular Formula | C18H23BN2O4 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H](C(=O)N1C(=O)OC[C@@H]1C(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H23BN2O4/c1-11(2)13-10-25-17(24)21(13)15(22)14(20-16(19)23)18(3,4)12-8-6-5-7-9-12/h5-9,11,13-14H,10H2,1-4H3,(H,20,23)/t13-,14-/m1/s1 |
| InChIKey | OQXMNEKOEWQUFV-ZIAGYGMSSA-N |
| XLogP | 2.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|