About ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate
ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate (PubChem CID 58822399) has the molecular formula C15H28N2O3
and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate.
Molecular Properties
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate |
| PubChem CID | 58822399 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C)N(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-8-20-14(19)10(2)9-11(3)17(7)13(18)12(16)15(4,5)6/h9,11-12H,8,16H2,1-7H3/b10-9+/t11-,12+/m0/s1 |
| InChIKey | PIGXKLKSZFMCBN-NYXKHXTOSA-N |
| XLogP | 1.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate?
The IUPAC name of ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate (CID 58822399) is ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate.
What is the SMILES notation for ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate?
The canonical SMILES for ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate is CCOC(=O)/C(C)=C/[C@H](C)N(C)C(=O)[C@@H](N)C(C)(C)C.
What is the InChIKey of ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate?
The InChIKey is PIGXKLKSZFMCBN-NYXKHXTOSA-N. The full InChI is InChI=1S/C15H28N2O3/c1-8-20-14(19)10(2)9-11(3)17(7)13(18)12(16)15(4,5)6/h9,11-12H,8,16H2,1-7H3/b10-9+/t11-,12+/m0/s1.
What are the key properties of ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate?
ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate has a molecular weight of 284.40 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E,4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate is sourced from PubChem (CID 58822399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).