C25H33ClN2O3S — CID 58822451
N-[1-[(3R)-3-chloro-3-phenylpropyl]piperidin-4-yl]-N-ethyl-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 58822451) has the molecular formula C25H33ClN2O3S and a molecular weight of 477.07 g/mol. Its IUPAC name is N-[1-[(3R)-3-chloro-3-phenylpropyl]piperidin-4-yl]-N-ethyl-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-[1-[(3R)-3-chloro-3-phenylpropyl]piperidin-4-yl]-N-ethyl-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 58822451 |
| Molecular Formula | C25H33ClN2O3S |
| Molecular Weight | 477.07 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[1-[(3R)-3-chloro-3-phenylpropyl]piperidin-4-yl]-N-ethyl-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | CCN(C(=O)Cc1ccc(S(C)(=O)=O)cc1)C1CCN(CC[C@@H](Cl)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H33ClN2O3S/c1-3-28(25(29)19-20-9-11-23(12-10-20)32(2,30)31)22-13-16-27(17-14-22)18-15-24(26)21-7-5-4-6-8-21/h4-12,22,24H,3,13-19H2,1-2H3/t24-/m1/s1 |
| InChIKey | UEVHPDNBYITVDF-XMMPIXPASA-N |
| XLogP | 4.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.07 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|