C30H64O3Si2 — CID 58822514
(Z)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltetradec-10-en-2-ol (PubChem CID 58822514) has the molecular formula C30H64O3Si2 and a molecular weight of 529.01 g/mol. Its IUPAC name is (Z)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltetradec-10-en-2-ol.
| Compound Name | (Z)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltetradec-10-en-2-ol |
|---|---|
| PubChem CID | 58822514 |
| Molecular Formula | C30H64O3Si2 |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.44 |
| IUPAC Name | (Z)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltetradec-10-en-2-ol |
| SMILES | CCC/C=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)O |
| InChI | InChI=1S/C30H64O3Si2/c1-17-18-19-20-22(2)27(32-34(13,14)29(7,8)9)23(3)21-24(4)28(25(5)26(6)31)33-35(15,16)30(10,11)12/h19-20,22-28,31H,17-18,21H2,1-16H3/b20-19- |
| InChIKey | VQIKHSDQQILFGN-VXPUYCOJSA-N |
| XLogP | 9.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|