C42H78O4Si2 — CID 58822531
(3Z,5S,6S,7S,8Z,15S,16Z)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclopentyl-14-hydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraen-2-one (PubChem CID 58822531) has the molecular formula C42H78O4Si2 and a molecular weight of 703.25 g/mol. Its IUPAC name is (3Z,5S,6S,7S,8Z,15S,16Z)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclopentyl-14-hydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraen-2-one.
| Compound Name | (3Z,5S,6S,7S,8Z,15S,16Z)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclopentyl-14-hydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraen-2-one |
|---|---|
| PubChem CID | 58822531 |
| Molecular Formula | C42H78O4Si2 |
| Molecular Weight | 703.25 g/mol |
| Exact Mass | 702.54 |
| IUPAC Name | (3Z,5S,6S,7S,8Z,15S,16Z)-6,12-bis[[tert-butyl(dimethyl)silyl]oxy]-1-cyclopentyl-14-hydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraen-2-one |
| SMILES | C=C/C=C\[C@H](C)C(O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\C(=O)CC1CCCC1 |
| InChI | InChI=1S/C42H78O4Si2/c1-18-19-22-31(3)38(44)35(7)40(46-48(16,17)42(11,12)13)34(6)28-30(2)27-33(5)39(45-47(14,15)41(8,9)10)32(4)25-26-37(43)29-36-23-20-21-24-36/h18-19,22,25-27,31-36,38-40,44H,1,20-21,23-24,28-29H2,2-17H3/b22-19-,26-25-,30-27-/t31-,32-,33-,34?,35?,38?,39-,40?/m0/s1 |
| InChIKey | UXTAIIPTZNPGGT-NNTLNBQRSA-N |
| XLogP | 12.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.25 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|