C30H64O4Si2 — CID 58822534
tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethoxy-4,6,8,10-tetramethyldodec-2-en-5-yl]oxy-dimethylsilane (PubChem CID 58822534) has the molecular formula C30H64O4Si2 and a molecular weight of 545.01 g/mol. Its IUPAC name is tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethoxy-4,6,8,10-tetramethyldodec-2-en-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethoxy-4,6,8,10-tetramethyldodec-2-en-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 58822534 |
| Molecular Formula | C30H64O4Si2 |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.43 |
| IUPAC Name | tert-butyl-[(Z)-9-[tert-butyl(dimethyl)silyl]oxy-1,11-dimethoxy-4,6,8,10-tetramethyldodec-2-en-5-yl]oxy-dimethylsilane |
| SMILES | COC/C=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)OC |
| InChI | InChI=1S/C30H64O4Si2/c1-22(19-18-20-31-12)27(33-35(14,15)29(6,7)8)23(2)21-24(3)28(25(4)26(5)32-13)34-36(16,17)30(9,10)11/h18-19,22-28H,20-21H2,1-17H3/b19-18- |
| InChIKey | KYEAKCZRUVDDJS-HNENSFHCSA-N |
| XLogP | 8.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|