C31H66O4Si2 — CID 58822540
(Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methoxy-6,8,10,12-tetramethyltetradec-4-en-3-ol (PubChem CID 58822540) has the molecular formula C31H66O4Si2 and a molecular weight of 559.04 g/mol. Its IUPAC name is (Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methoxy-6,8,10,12-tetramethyltetradec-4-en-3-ol.
| Compound Name | (Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methoxy-6,8,10,12-tetramethyltetradec-4-en-3-ol |
|---|---|
| PubChem CID | 58822540 |
| Molecular Formula | C31H66O4Si2 |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.45 |
| IUPAC Name | (Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methoxy-6,8,10,12-tetramethyltetradec-4-en-3-ol |
| SMILES | CCC(O)/C=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)OC |
| InChI | InChI=1S/C31H66O4Si2/c1-18-27(32)20-19-22(2)28(34-36(14,15)30(7,8)9)23(3)21-24(4)29(25(5)26(6)33-13)35-37(16,17)31(10,11)12/h19-20,22-29,32H,18,21H2,1-17H3/b20-19- |
| InChIKey | YHVPUXFXFKRYLJ-VXPUYCOJSA-N |
| XLogP | 9.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|