C30H62O4Si2 — CID 58822542
(Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-6,8,10,12-tetramethyltetradec-4-en-3-one (PubChem CID 58822542) has the molecular formula C30H62O4Si2 and a molecular weight of 542.99 g/mol. Its IUPAC name is (Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-6,8,10,12-tetramethyltetradec-4-en-3-one.
| Compound Name | (Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-6,8,10,12-tetramethyltetradec-4-en-3-one |
|---|---|
| PubChem CID | 58822542 |
| Molecular Formula | C30H62O4Si2 |
| Molecular Weight | 542.99 g/mol |
| Exact Mass | 542.42 |
| IUPAC Name | (Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-13-hydroxy-6,8,10,12-tetramethyltetradec-4-en-3-one |
| SMILES | CCC(=O)/C=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)O |
| InChI | InChI=1S/C30H62O4Si2/c1-17-26(32)19-18-21(2)27(33-35(13,14)29(7,8)9)22(3)20-23(4)28(24(5)25(6)31)34-36(15,16)30(10,11)12/h18-19,21-25,27-28,31H,17,20H2,1-16H3/b19-18- |
| InChIKey | WLNDTUJFGKCEBB-HNENSFHCSA-N |
| XLogP | 8.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.99 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|