C30H66O4Si2 — CID 58822549
tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethyl-7-propoxyheptoxy]-dimethylsilane (PubChem CID 58822549) has the molecular formula C30H66O4Si2 and a molecular weight of 547.03 g/mol. Its IUPAC name is tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethyl-7-propoxyheptoxy]-dimethylsilane.
| Compound Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethyl-7-propoxyheptoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58822549 |
| Molecular Formula | C30H66O4Si2 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.45 |
| IUPAC Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxybutan-2-yl)-2,4,6-trimethyl-7-propoxyheptoxy]-dimethylsilane |
| SMILES | CCCOCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)OC |
| InChI | InChI=1S/C30H66O4Si2/c1-18-19-32-21-24(4)27(33-35(14,15)29(7,8)9)22(2)20-23(3)28(25(5)26(6)31-13)34-36(16,17)30(10,11)12/h22-28H,18-21H2,1-17H3 |
| InChIKey | XOWPRUZFSIWUSB-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|