About 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate
1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58823497) has the molecular formula C15H23F3O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 58823497 |
| Molecular Formula | C15H23F3O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(C)OC(=O)C1(C(F)(F)F)CC2CC1C(C)C2C |
| InChI | InChI=1S/C15H23F3O3/c1-5-20-10(4)21-13(19)14(15(16,17)18)7-11-6-12(14)9(3)8(11)2/h8-12H,5-7H2,1-4H3 |
| InChIKey | XPVKHGQLPBUXCQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate (CID 58823497) is 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate is CCOC(C)OC(=O)C1(C(F)(F)F)CC2CC1C(C)C2C.
What is the InChIKey of 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is XPVKHGQLPBUXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F3O3/c1-5-20-10(4)21-13(19)14(15(16,17)18)7-11-6-12(14)9(3)8(11)2/h8-12H,5-7H2,1-4H3.
What are the key properties of 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate?
1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 308.34 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethyl 5,6-dimethyl-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 58823497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).