C22H29F9O5 — CID 58823525
tert-butyl 6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-methylbutanoyl]oxy-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58823525) has the molecular formula C22H29F9O5 and a molecular weight of 544.45 g/mol. Its IUPAC name is tert-butyl 6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-methylbutanoyl]oxy-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-methylbutanoyl]oxy-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58823525 |
| Molecular Formula | C22H29F9O5 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | tert-butyl 6-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-methylbutanoyl]oxy-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(C)(COC(C(F)(F)F)C(F)(F)F)C(=O)OC1CC2CC1C(C(=O)OC(C)(C)C)(C(F)(F)F)C2 |
| InChI | InChI=1S/C22H29F9O5/c1-6-18(5,10-34-14(20(23,24)25)21(26,27)28)15(32)35-13-8-11-7-12(13)19(9-11,22(29,30)31)16(33)36-17(2,3)4/h11-14H,6-10H2,1-5H3 |
| InChIKey | MAOVPXVZEQXODR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |