C36H49F9O3 — CID 58823651
[1,1,1-trifluoro-2-[4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-5-methyl-6-(2-methyl-2-adamantyl)hexan-3-yl]phenyl]propan-2-yl] 2,2-dimethylpropanoate (PubChem CID 58823651) has the molecular formula C36H49F9O3 and a molecular weight of 700.77 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-[4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-5-methyl-6-(2-methyl-2-adamantyl)hexan-3-yl]phenyl]propan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [1,1,1-trifluoro-2-[4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-5-methyl-6-(2-methyl-2-adamantyl)hexan-3-yl]phenyl]propan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58823651 |
| Molecular Formula | C36H49F9O3 |
| Molecular Weight | 700.77 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | [1,1,1-trifluoro-2-[4-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-5-methyl-6-(2-methyl-2-adamantyl)hexan-3-yl]phenyl]propan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CCC(CC(C)(COC(C(F)(F)F)C(F)(F)F)CC1(C)C2CC3CC(C2)CC1C3)c1ccc(C(C)(OC(=O)C(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H49F9O3/c1-8-23(24-9-11-25(12-10-24)33(7,36(43,44)45)48-29(46)30(2,3)4)18-31(5,20-47-28(34(37,38)39)35(40,41)42)19-32(6)26-14-21-13-22(16-26)17-27(32)15-21/h9-12,21-23,26-28H,8,13-20H2,1-7H3 |
| InChIKey | HNDOYNWIPDCDIK-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.77 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |