About 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene
2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene (PubChem CID 58823870) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene.
Molecular Properties
| Compound Name | 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene |
| PubChem CID | 58823870 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene |
| SMILES | C1CC2=NC3CCCC3N=C2C1 |
| InChI | InChI=1S/C10H14N2/c1-3-7-8(4-1)12-10-6-2-5-9(10)11-7/h7-8H,1-6H2 |
| InChIKey | LXGLTVXSTCIKLQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene?
The IUPAC name of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene (CID 58823870) is 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene.
What is the SMILES notation for 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene?
The canonical SMILES for 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene is C1CC2=NC3CCCC3N=C2C1.
What is the InChIKey of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene?
The InChIKey is LXGLTVXSTCIKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-3-7-8(4-1)12-10-6-2-5-9(10)11-7/h7-8H,1-6H2.
What are the key properties of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene?
2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene has a molecular weight of 162.24 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,8-diene is sourced from PubChem (CID 58823870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).