C39H34F2N12 — CID 58824369
N,N'-bis[[3-(2-aminopyrimidin-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-7-yl]methyl]-N,N'-dimethylmethanediamine (PubChem CID 58824369) has the molecular formula C39H34F2N12 and a molecular weight of 708.78 g/mol. Its IUPAC name is N,N'-bis[[3-(2-aminopyrimidin-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-7-yl]methyl]-N,N'-dimethylmethanediamine.
| Compound Name | N,N'-bis[[3-(2-aminopyrimidin-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-7-yl]methyl]-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 58824369 |
| Molecular Formula | C39H34F2N12 |
| Molecular Weight | 708.78 g/mol |
| Exact Mass | 708.30 |
| IUPAC Name | N,N'-bis[[3-(2-aminopyrimidin-4-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-7-yl]methyl]-N,N'-dimethylmethanediamine |
| SMILES | CN(Cc1ccn2c(-c3ccnc(N)n3)c(-c3ccc(F)cc3)nc2c1)CN(C)Cc1ccn2c(-c3ccnc(N)n3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C39H34F2N12/c1-50(21-24-13-17-52-32(19-24)48-34(26-3-7-28(40)8-4-26)36(52)30-11-15-44-38(42)46-30)23-51(2)22-25-14-18-53-33(20-25)49-35(27-5-9-29(41)10-6-27)37(53)31-12-16-45-39(43)47-31/h3-20H,21-23H2,1-2H3,(H2,42,44,46)(H2,43,45,47) |
| InChIKey | NYLXNOFAJHYWJQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.78 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|