C24H24F3N5O2 — CID 58824434
[3-[2-(3-ethoxypropylamino)pyrimidin-4-yl]-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methanol (PubChem CID 58824434) has the molecular formula C24H24F3N5O2 and a molecular weight of 471.48 g/mol. Its IUPAC name is [3-[2-(3-ethoxypropylamino)pyrimidin-4-yl]-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methanol.
| Compound Name | [3-[2-(3-ethoxypropylamino)pyrimidin-4-yl]-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 58824434 |
| Molecular Formula | C24H24F3N5O2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [3-[2-(3-ethoxypropylamino)pyrimidin-4-yl]-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-7-yl]methanol |
| SMILES | CCOCCCNc1nccc(-c2c(-c3cccc(C(F)(F)F)c3)nc3cc(CO)ccn23)n1 |
| InChI | InChI=1S/C24H24F3N5O2/c1-2-34-12-4-9-28-23-29-10-7-19(30-23)22-21(17-5-3-6-18(14-17)24(25,26)27)31-20-13-16(15-33)8-11-32(20)22/h3,5-8,10-11,13-14,33H,2,4,9,12,15H2,1H3,(H,28,29,30) |
| InChIKey | WGWDEQTVCMLKMP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|