C27H21F3N8 — CID 58824666
4-[8-(azidomethyl)-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]-N-[(1S)-1-phenylethyl]pyrimidin-2-amine (PubChem CID 58824666) has the molecular formula C27H21F3N8 and a molecular weight of 514.52 g/mol. Its IUPAC name is 4-[8-(azidomethyl)-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]-N-[(1S)-1-phenylethyl]pyrimidin-2-amine.
| Compound Name | 4-[8-(azidomethyl)-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]-N-[(1S)-1-phenylethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58824666 |
| Molecular Formula | C27H21F3N8 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 4-[8-(azidomethyl)-2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-3-yl]-N-[(1S)-1-phenylethyl]pyrimidin-2-amine |
| SMILES | C[C@H](Nc1nccc(-c2c(-c3cccc(C(F)(F)F)c3)nc3c(CN=[N+]=[N-])cccn23)n1)c1ccccc1 |
| InChI | InChI=1S/C27H21F3N8/c1-17(18-7-3-2-4-8-18)34-26-32-13-12-22(35-26)24-23(19-9-5-11-21(15-19)27(28,29)30)36-25-20(16-33-37-31)10-6-14-38(24)25/h2-15,17H,16H2,1H3,(H,32,34,35)/t17-/m0/s1 |
| InChIKey | XHJUTZYVTDFYAA-KRWDZBQOSA-N |
| XLogP | 7.46 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|