About N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine
N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine (PubChem CID 58824815) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine.
Analyze N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine?
The IUPAC name of N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine (CID 58824815) is N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine.
What is the SMILES notation for N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine?
The canonical SMILES for N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine is CCNc1n[nH]c2c1CCC2.
What is the InChIKey of N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine?
The InChIKey is YQVSBJASQZGSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-9-8-6-4-3-5-7(6)10-11-8/h2-5H2,1H3,(H2,9,10,11).
What are the key properties of N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine?
N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine has a molecular weight of 151.21 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-amine is sourced from PubChem (CID 58824815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).