About 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid
3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid (PubChem CID 58824830) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid |
| PubChem CID | 58824830 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid |
| SMILES | CCNc1nn(C(=O)O)c2c1CCC2 |
| InChI | InChI=1S/C9H13N3O2/c1-2-10-8-6-4-3-5-7(6)12(11-8)9(13)14/h2-5H2,1H3,(H,10,11)(H,13,14) |
| InChIKey | HCXBRJYZRWQVHX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid?
The IUPAC name of 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid (CID 58824830) is 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid.
What is the SMILES notation for 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid?
The canonical SMILES for 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid is CCNc1nn(C(=O)O)c2c1CCC2.
What is the InChIKey of 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid?
The InChIKey is HCXBRJYZRWQVHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-2-10-8-6-4-3-5-7(6)12(11-8)9(13)14/h2-5H2,1H3,(H,10,11)(H,13,14).
What are the key properties of 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid?
3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-5,6-dihydro-4H-cyclopenta[d]pyrazole-1-carboxylic acid is sourced from PubChem (CID 58824830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).