About 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone
1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone (PubChem CID 58824902) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone |
| PubChem CID | 58824902 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone |
| SMILES | CCNc1c2c(nn1C(C)=O)CCC2 |
| InChI | InChI=1S/C10H15N3O/c1-3-11-10-8-5-4-6-9(8)12-13(10)7(2)14/h11H,3-6H2,1-2H3 |
| InChIKey | KYCKQWNGGDLKAY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone?
The IUPAC name of 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone (CID 58824902) is 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone.
What is the SMILES notation for 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone?
The canonical SMILES for 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone is CCNc1c2c(nn1C(C)=O)CCC2.
What is the InChIKey of 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone?
The InChIKey is KYCKQWNGGDLKAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-3-11-10-8-5-4-6-9(8)12-13(10)7(2)14/h11H,3-6H2,1-2H3.
What are the key properties of 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone?
1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone has a molecular weight of 193.25 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(ethylamino)-5,6-dihydro-4H-cyclopenta[c]pyrazol-2-yl]ethanone is sourced from PubChem (CID 58824902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).